C27H26F6N4O6S — CID 162772662
tert-butyl N-[(8Z)-12,12-dioxo-6-phenylmethoxy-6,14-bis(trifluoromethyl)-18-oxa-12λ6-thia-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate (PubChem CID 162772662) has the molecular formula C27H26F6N4O6S and a molecular weight of 648.58 g/mol. Its IUPAC name is tert-butyl N-[(8Z)-12,12-dioxo-6-phenylmethoxy-6,14-bis(trifluoromethyl)-18-oxa-12λ6-thia-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate.
| Compound Name | tert-butyl N-[(8Z)-12,12-dioxo-6-phenylmethoxy-6,14-bis(trifluoromethyl)-18-oxa-12λ6-thia-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate |
|---|---|
| PubChem CID | 162772662 |
| Molecular Formula | C27H26F6N4O6S |
| Molecular Weight | 648.58 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | tert-butyl N-[(8Z)-12,12-dioxo-6-phenylmethoxy-6,14-bis(trifluoromethyl)-18-oxa-12λ6-thia-3,4,17-triazatricyclo[11.3.1.12,5]octadeca-1(16),2,4,8,13(17),14-hexaen-16-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)C/C=C\CCS2(=O)=O |
| InChI | InChI=1S/C27H26F6N4O6S/c1-24(2,3)43-23(38)34-18-14-17(26(28,29)30)21-35-19(18)20-36-37-22(42-20)25(27(31,32)33,12-8-5-9-13-44(21,39)40)41-15-16-10-6-4-7-11-16/h4-8,10-11,14H,9,12-13,15H2,1-3H3,(H,34,38)/b8-5- |
| InChIKey | XWIROMVEIARKQA-YVMONPNESA-N |
| XLogP | 6.60 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|