C36H39F3N4O6 — CID 163823279
tert-butyl N-[(6R,12R)-12,15-dimethyl-6,11-bis(phenylmethoxy)-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-17-yl]carbamate (PubChem CID 163823279) has the molecular formula C36H39F3N4O6 and a molecular weight of 680.72 g/mol. Its IUPAC name is tert-butyl N-[(6R,12R)-12,15-dimethyl-6,11-bis(phenylmethoxy)-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-17-yl]carbamate.
| Compound Name | tert-butyl N-[(6R,12R)-12,15-dimethyl-6,11-bis(phenylmethoxy)-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-17-yl]carbamate |
|---|---|
| PubChem CID | 163823279 |
| Molecular Formula | C36H39F3N4O6 |
| Molecular Weight | 680.72 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | tert-butyl N-[(6R,12R)-12,15-dimethyl-6,11-bis(phenylmethoxy)-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-17-yl]carbamate |
| SMILES | Cc1cc(NC(=O)OC(C)(C)C)c2nc1O[C@H](C)C(OCc1ccccc1)CC=CC[C@](OCc1ccccc1)(C(F)(F)F)c1nnc-2o1 |
| InChI | InChI=1S/C36H39F3N4O6/c1-23-20-27(40-33(44)49-34(3,4)5)29-31-42-43-32(48-31)35(36(37,38)39,46-22-26-16-10-7-11-17-26)19-13-12-18-28(24(2)47-30(23)41-29)45-21-25-14-8-6-9-15-25/h6-17,20,24,28H,18-19,21-22H2,1-5H3,(H,40,44)/t24-,28?,35-/m1/s1 |
| InChIKey | AFVCUFIKUXZCIJ-PATIPRTCSA-N |
| XLogP | 8.46 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.72 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|