C26H26F3N3O5 — CID 163684230
methyl (6R,12R)-12,15-dimethyl-6-phenylmethoxy-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-17-carboxylate (PubChem CID 163684230) has the molecular formula C26H26F3N3O5 and a molecular weight of 517.50 g/mol. Its IUPAC name is methyl (6R,12R)-12,15-dimethyl-6-phenylmethoxy-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-17-carboxylate.
| Compound Name | methyl (6R,12R)-12,15-dimethyl-6-phenylmethoxy-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-17-carboxylate |
|---|---|
| PubChem CID | 163684230 |
| Molecular Formula | C26H26F3N3O5 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | methyl (6R,12R)-12,15-dimethyl-6-phenylmethoxy-6-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-17-carboxylate |
| SMILES | COC(=O)c1cc(C)c2nc1-c1nnc(o1)[C@@](OCc1ccccc1)(C(F)(F)F)CCC=CC[C@@H](C)O2 |
| InChI | InChI=1S/C26H26F3N3O5/c1-16-14-19(23(33)34-3)20-22-31-32-24(37-22)25(26(27,28)29,35-15-18-11-7-4-8-12-18)13-9-5-6-10-17(2)36-21(16)30-20/h4-8,11-12,14,17H,9-10,13,15H2,1-3H3/t17-,25-/m1/s1 |
| InChIKey | YPZXUQANPTUKSL-CRICUBBOSA-N |
| XLogP | 5.71 |
| TPSA | 96.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|