C25H26F6N4O4 — CID 162726584
(8E)-17-amino-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-7-ol;ethane (PubChem CID 162726584) has the molecular formula C25H26F6N4O4 and a molecular weight of 560.50 g/mol. Its IUPAC name is (8E)-17-amino-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-7-ol;ethane.
| Compound Name | (8E)-17-amino-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-7-ol;ethane |
|---|---|
| PubChem CID | 162726584 |
| Molecular Formula | C25H26F6N4O4 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | (8E)-17-amino-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-7-ol;ethane |
| SMILES | CC.Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)C(O)/C=C/CCCO2 |
| InChI | InChI=1S/C23H20F6N4O4.C2H6/c24-22(25,26)14-11-15(30)17-19-32-33-20(37-19)21(23(27,28)29,36-12-13-7-3-1-4-8-13)16(34)9-5-2-6-10-35-18(14)31-17;1-2/h1,3-5,7-9,11,16,34H,2,6,10,12,30H2;1-2H3/b9-5+; |
| InChIKey | YCONLMGVIIZCRI-SZKNIZGXSA-N |
| XLogP | 5.82 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|