C16H10F3N3O3 — CID 18921375
2-(oxiran-2-yl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole (PubChem CID 18921375) has the molecular formula C16H10F3N3O3 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-(oxiran-2-yl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole.
| Compound Name | 2-(oxiran-2-yl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 18921375 |
| Molecular Formula | C16H10F3N3O3 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(oxiran-2-yl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1cccc(Oc2cccc(-c3nnc(C4CO4)o3)n2)c1 |
| InChI | InChI=1S/C16H10F3N3O3/c17-16(18,19)9-3-1-4-10(7-9)24-13-6-2-5-11(20-13)14-21-22-15(25-14)12-8-23-12/h1-7,12H,8H2 |
| InChIKey | UXHDBHSUMOTVQH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|