C30H29F9N4O5 — CID 169137234
tert-butyl N-[(9Z)-13-hydroxy-6-phenylmethoxy-6,13,15-tris(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate (PubChem CID 169137234) has the molecular formula C30H29F9N4O5 and a molecular weight of 696.57 g/mol. Its IUPAC name is tert-butyl N-[(9Z)-13-hydroxy-6-phenylmethoxy-6,13,15-tris(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate.
| Compound Name | tert-butyl N-[(9Z)-13-hydroxy-6-phenylmethoxy-6,13,15-tris(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate |
|---|---|
| PubChem CID | 169137234 |
| Molecular Formula | C30H29F9N4O5 |
| Molecular Weight | 696.57 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | tert-butyl N-[(9Z)-13-hydroxy-6-phenylmethoxy-6,13,15-tris(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)CC/C=C/CCC2(O)C(F)(F)F |
| InChI | InChI=1S/C30H29F9N4O5/c1-25(2,3)48-24(44)40-19-15-18(28(31,32)33)21-26(45,29(34,35)36)13-9-4-5-10-14-27(30(37,38)39,46-16-17-11-7-6-8-12-17)23-43-42-22(47-23)20(19)41-21/h4-8,11-12,15,45H,9-10,13-14,16H2,1-3H3,(H,40,44)/b5-4+ |
| InChIKey | MEFRILSZUXUEAB-SNAWJCMRSA-N |
| XLogP | 8.35 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.57 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|