C31H33F6N5O6 — CID 175741304
ethyl 17-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12-carboxylate (PubChem CID 175741304) has the molecular formula C31H33F6N5O6 and a molecular weight of 685.62 g/mol. Its IUPAC name is ethyl 17-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12-carboxylate.
| Compound Name | ethyl 17-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 175741304 |
| Molecular Formula | C31H33F6N5O6 |
| Molecular Weight | 685.62 g/mol |
| Exact Mass | 685.23 |
| IUPAC Name | ethyl 17-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12-carboxylate |
| SMILES | CCOC(=O)C1CC=CCCC(OCc2ccccc2)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2NC(=O)OC(C)(C)C)N1 |
| InChI | InChI=1S/C31H33F6N5O6/c1-5-45-25(43)20-14-10-7-11-15-29(31(35,36)37,46-17-18-12-8-6-9-13-18)26-42-41-24(47-26)22-21(39-27(44)48-28(2,3)4)16-19(30(32,33)34)23(38-20)40-22/h6-10,12-13,16,20H,5,11,14-15,17H2,1-4H3,(H,38,40)(H,39,44) |
| InChIKey | ZOOOCLJAINDJNG-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 137.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|