C28H34BrF3N4O5 — CID 169126043
tert-butyl N-[6-bromo-2-[5-[(1R,7S)-7-hydroxy-1-phenylmethoxyoctyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 169126043) has the molecular formula C28H34BrF3N4O5 and a molecular weight of 643.50 g/mol. Its IUPAC name is tert-butyl N-[6-bromo-2-[5-[(1R,7S)-7-hydroxy-1-phenylmethoxyoctyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-bromo-2-[5-[(1R,7S)-7-hydroxy-1-phenylmethoxyoctyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169126043 |
| Molecular Formula | C28H34BrF3N4O5 |
| Molecular Weight | 643.50 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | tert-butyl N-[6-bromo-2-[5-[(1R,7S)-7-hydroxy-1-phenylmethoxyoctyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | C[C@H](O)CCCCC[C@@H](OCc1ccccc1)c1nnc(-c2nc(Br)c(C(F)(F)F)cc2NC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C28H34BrF3N4O5/c1-17(37)11-7-5-10-14-21(39-16-18-12-8-6-9-13-18)24-35-36-25(40-24)22-20(33-26(38)41-27(2,3)4)15-19(23(29)34-22)28(30,31)32/h6,8-9,12-13,15,17,21,37H,5,7,10-11,14,16H2,1-4H3,(H,33,38)/t17-,21+/m0/s1 |
| InChIKey | TZLGVBQEUBSARD-LAUBAEHRSA-N |
| XLogP | 7.85 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.50 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|