C25H26F6N6O4 — CID 170117490
tert-butyl N-[6-(5-but-3-enyl-1,3,4-oxadiazol-2-yl)-2-[5-(1,1,1-trifluorohex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 170117490) has the molecular formula C25H26F6N6O4 and a molecular weight of 588.51 g/mol. Its IUPAC name is tert-butyl N-[6-(5-but-3-enyl-1,3,4-oxadiazol-2-yl)-2-[5-(1,1,1-trifluorohex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(5-but-3-enyl-1,3,4-oxadiazol-2-yl)-2-[5-(1,1,1-trifluorohex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 170117490 |
| Molecular Formula | C25H26F6N6O4 |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | tert-butyl N-[6-(5-but-3-enyl-1,3,4-oxadiazol-2-yl)-2-[5-(1,1,1-trifluorohex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | C=CCCc1nnc(-c2nc(-c3nnc(C(CCC=C)C(F)(F)F)o3)c(NC(=O)OC(C)(C)C)cc2C(F)(F)F)o1 |
| InChI | InChI=1S/C25H26F6N6O4/c1-6-8-10-13(24(26,27)28)19-35-37-21(40-19)18-15(32-22(38)41-23(3,4)5)12-14(25(29,30)31)17(33-18)20-36-34-16(39-20)11-9-7-2/h6-7,12-13H,1-2,8-11H2,3-5H3,(H,32,38) |
| InChIKey | JBGXAWNNGCPWKL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|