C28H30F6N4O4S — CID 162726751
tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-6,15-bis(trifluoromethyl)-19-oxa-13-thia-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate (PubChem CID 162726751) has the molecular formula C28H30F6N4O4S and a molecular weight of 632.63 g/mol. Its IUPAC name is tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-6,15-bis(trifluoromethyl)-19-oxa-13-thia-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate.
| Compound Name | tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-6,15-bis(trifluoromethyl)-19-oxa-13-thia-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate |
|---|---|
| PubChem CID | 162726751 |
| Molecular Formula | C28H30F6N4O4S |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-6,15-bis(trifluoromethyl)-19-oxa-13-thia-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate |
| SMILES | C=C/C=C(\C=C)COC1(C(F)(F)F)CC/C=C\CCSc2nc(c(NC(=O)OC(C)(C)C)cc2C(F)(F)F)-c2nnc1o2 |
| InChI | InChI=1S/C28H30F6N4O4S/c1-6-12-17(7-2)16-40-26(28(32,33)34)13-10-8-9-11-14-43-22-18(27(29,30)31)15-19(35-24(39)42-25(3,4)5)20(36-22)21-37-38-23(26)41-21/h6-9,12,15H,1-2,10-11,13-14,16H2,3-5H3,(H,35,39)/b9-8-,17-12+ |
| InChIKey | HOEOIYVVOQYQDN-PQUFBVFYSA-N |
| XLogP | 8.40 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|