C34H36F6N4O5 — CID 169136827
tert-butyl N-[6-(1-but-3-enylcyclobutanecarbonyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate (PubChem CID 169136827) has the molecular formula C34H36F6N4O5 and a molecular weight of 694.67 g/mol. Its IUPAC name is tert-butyl N-[6-(1-but-3-enylcyclobutanecarbonyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(1-but-3-enylcyclobutanecarbonyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169136827 |
| Molecular Formula | C34H36F6N4O5 |
| Molecular Weight | 694.67 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | tert-butyl N-[6-(1-but-3-enylcyclobutanecarbonyl)-5-(trifluoromethyl)-2-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]-3-pyridinyl]carbamate |
| SMILES | C=CCCC1(C(=O)c2nc(-c3nnc([C@@](CC=C)(OCc4ccccc4)C(F)(F)F)o3)c(NC(=O)OC(C)(C)C)cc2C(F)(F)F)CCC1 |
| InChI | InChI=1S/C34H36F6N4O5/c1-6-8-16-31(17-12-18-31)26(45)24-22(33(35,36)37)19-23(41-29(46)49-30(3,4)5)25(42-24)27-43-44-28(48-27)32(15-7-2,34(38,39)40)47-20-21-13-10-9-11-14-21/h6-7,9-11,13-14,19H,1-2,8,12,15-18,20H2,3-5H3,(H,41,46)/t32-/m1/s1 |
| InChIKey | NAPQOWXCAHTRAO-JGCGQSQUSA-N |
| XLogP | 9.37 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.67 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|