C28H28F6N4O8 — CID 169136931
methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-3-(3-oxopropoxy)-2-phenylmethoxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate (PubChem CID 169136931) has the molecular formula C28H28F6N4O8 and a molecular weight of 662.54 g/mol. Its IUPAC name is methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-3-(3-oxopropoxy)-2-phenylmethoxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-3-(3-oxopropoxy)-2-phenylmethoxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 169136931 |
| Molecular Formula | C28H28F6N4O8 |
| Molecular Weight | 662.54 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-3-(3-oxopropoxy)-2-phenylmethoxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2nnc(C(COCCC=O)(OCc3ccccc3)C(F)(F)F)o2)c(NC(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C28H28F6N4O8/c1-25(2,3)46-24(41)35-18-13-17(27(29,30)31)19(22(40)42-4)36-20(18)21-37-38-23(45-21)26(28(32,33)34,15-43-12-8-11-39)44-14-16-9-6-5-7-10-16/h5-7,9-11,13H,8,12,14-15H2,1-4H3,(H,35,41) |
| InChIKey | ILCMESWRHGOHHH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|