C14H17F3O3 — CID 170115292
2-phenylmethoxy-2-(trifluoromethyl)hex-5-ene-1,1-diol (PubChem CID 170115292) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-phenylmethoxy-2-(trifluoromethyl)hex-5-ene-1,1-diol.
| Compound Name | 2-phenylmethoxy-2-(trifluoromethyl)hex-5-ene-1,1-diol |
|---|---|
| PubChem CID | 170115292 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-phenylmethoxy-2-(trifluoromethyl)hex-5-ene-1,1-diol |
| SMILES | C=CCCC(OCc1ccccc1)(C(O)O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O3/c1-2-3-9-13(12(18)19,14(15,16)17)20-10-11-7-5-4-6-8-11/h2,4-8,12,18-19H,1,3,9-10H2 |
| InChIKey | JSUGXFLMGDWGEP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|