C31H36O4 — CID 24769876
(3R,4S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)nona-1,8-dien-5-ol (PubChem CID 24769876) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is (3R,4S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)nona-1,8-dien-5-ol.
| Compound Name | (3R,4S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)nona-1,8-dien-5-ol |
|---|---|
| PubChem CID | 24769876 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (3R,4S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)nona-1,8-dien-5-ol |
| SMILES | C=CCCC(O)(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C31H36O4/c1-3-5-21-31(32,25-33-22-26-15-9-6-10-16-26)30(35-24-28-19-13-8-14-20-28)29(4-2)34-23-27-17-11-7-12-18-27/h3-4,6-20,29-30,32H,1-2,5,21-25H2/t29-,30+,31?/m1/s1 |
| InChIKey | OCUAIWFYWPASJW-AWZUCMKVSA-N |
| XLogP | 6.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|