C37H46ClNO7Si — CID 66589849
1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 66589849) has the molecular formula C37H46ClNO7Si and a molecular weight of 680.31 g/mol. Its IUPAC name is 1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 66589849 |
| Molecular Formula | C37H46ClNO7Si |
| Molecular Weight | 680.31 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | 1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(OCCOc3ccccc3Cl)cc2)CC(CO[Si](C)(C)C(C)(C)C)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C37H46ClNO7Si/c1-7-42-35(40)32-24-39(36(41)45-25-27-13-9-8-10-14-27)29(26-46-47(5,6)37(2,3)4)23-31(32)28-17-19-30(20-18-28)43-21-22-44-34-16-12-11-15-33(34)38/h8-20,29H,7,21-26H2,1-6H3 |
| InChIKey | QEULOYPGNAYSHR-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.31 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|