C21H32N2O5Si — CID 141283580
6-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 141283580) has the molecular formula C21H32N2O5Si and a molecular weight of 420.58 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 141283580 |
| Molecular Formula | C21H32N2O5Si |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(C(=O)O)C2CCN(C(=O)OCc3ccccc3)C12 |
| InChI | InChI=1S/C21H32N2O5Si/c1-21(2,3)29(4,5)28-17-13-23(19(24)25)16-11-12-22(18(16)17)20(26)27-14-15-9-7-6-8-10-15/h6-10,16-18H,11-14H2,1-5H3,(H,24,25) |
| InChIKey | CYUJIFIIVTVVOC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|