C17H22N2O4 — CID 140994860
(2R)-2-[(2S,3S)-3-amino-1-phenylmethoxycarbonylpyrrolidin-2-yl]pent-4-enoic acid (PubChem CID 140994860) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R)-2-[(2S,3S)-3-amino-1-phenylmethoxycarbonylpyrrolidin-2-yl]pent-4-enoic acid.
| Compound Name | (2R)-2-[(2S,3S)-3-amino-1-phenylmethoxycarbonylpyrrolidin-2-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 140994860 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (2R)-2-[(2S,3S)-3-amino-1-phenylmethoxycarbonylpyrrolidin-2-yl]pent-4-enoic acid |
| SMILES | C=CC[C@@H](C(=O)O)[C@H]1[C@@H](N)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O4/c1-2-6-13(16(20)21)15-14(18)9-10-19(15)17(22)23-11-12-7-4-3-5-8-12/h2-5,7-8,13-15H,1,6,9-11,18H2,(H,20,21)/t13-,14+,15+/m1/s1 |
| InChIKey | RSBIWGQPEBGQPJ-ILXRZTDVSA-N |
| XLogP | 2.00 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|