C19H26N2O4 — CID 57105116
benzyl (2S,3R)-3-amino-2-[(2S)-1-ethoxy-1-oxopent-4-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 57105116) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is benzyl (2S,3R)-3-amino-2-[(2S)-1-ethoxy-1-oxopent-4-en-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3R)-3-amino-2-[(2S)-1-ethoxy-1-oxopent-4-en-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57105116 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | benzyl (2S,3R)-3-amino-2-[(2S)-1-ethoxy-1-oxopent-4-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C=CC[C@H](C(=O)OCC)[C@H]1[C@H](N)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O4/c1-3-8-15(18(22)24-4-2)17-16(20)11-12-21(17)19(23)25-13-14-9-6-5-7-10-14/h3,5-7,9-10,15-17H,1,4,8,11-13,20H2,2H3/t15-,16+,17-/m0/s1 |
| InChIKey | CGFGUBMIRMYDBS-BBWFWOEESA-N |
| XLogP | 2.48 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|