C28H44BrN3O4Si — CID 140843319
benzyl (2R,3S)-2-[3-[(6-amino-6-bromocyclohexa-2,4-dien-1-yl)amino]-2-hydroxypropyl]-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate (PubChem CID 140843319) has the molecular formula C28H44BrN3O4Si and a molecular weight of 594.67 g/mol. Its IUPAC name is benzyl (2R,3S)-2-[3-[(6-amino-6-bromocyclohexa-2,4-dien-1-yl)amino]-2-hydroxypropyl]-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-2-[3-[(6-amino-6-bromocyclohexa-2,4-dien-1-yl)amino]-2-hydroxypropyl]-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 140843319 |
| Molecular Formula | C28H44BrN3O4Si |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | benzyl (2R,3S)-2-[3-[(6-amino-6-bromocyclohexa-2,4-dien-1-yl)amino]-2-hydroxypropyl]-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCN(C(=O)OCc2ccccc2)[C@@H]1CC(O)CNC1C=CC=CC1(N)Br |
| InChI | InChI=1S/C28H44BrN3O4Si/c1-27(2,3)37(4,5)36-24-14-11-17-32(26(34)35-20-21-12-7-6-8-13-21)23(24)18-22(33)19-31-25-15-9-10-16-28(25,29)30/h6-10,12-13,15-16,22-25,31,33H,11,14,17-20,30H2,1-5H3/t22?,23-,24+,25?,28?/m1/s1 |
| InChIKey | OKUXYDYNJSCHLH-DDEDZMJTSA-N |
| XLogP | 5.06 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|