C27H42BrN3O2Si — CID 172690996
1-(2-amino-3-bromoanilino)-3-[(2R,3S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-2-yl]propan-2-ol (PubChem CID 172690996) has the molecular formula C27H42BrN3O2Si and a molecular weight of 548.64 g/mol. Its IUPAC name is 1-(2-amino-3-bromoanilino)-3-[(2R,3S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-2-yl]propan-2-ol.
| Compound Name | 1-(2-amino-3-bromoanilino)-3-[(2R,3S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 172690996 |
| Molecular Formula | C27H42BrN3O2Si |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 1-(2-amino-3-bromoanilino)-3-[(2R,3S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxypiperidin-2-yl]propan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCN(Cc2ccccc2)[C@@H]1CC(O)CNc1cccc(Br)c1N |
| InChI | InChI=1S/C27H42BrN3O2Si/c1-27(2,3)34(4,5)33-25-15-10-16-31(19-20-11-7-6-8-12-20)24(25)17-21(32)18-30-23-14-9-13-22(28)26(23)29/h6-9,11-14,21,24-25,30,32H,10,15-19,29H2,1-5H3/t21?,24-,25+/m1/s1 |
| InChIKey | BRGDUCFFDUOOLG-PEXCGTIESA-N |
| XLogP | 6.25 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|