C29H42BrN3O6Si — CID 141469979
benzyl (2R,3S)-2-[3-(4-bromo-2-nitroanilino)-2-hydroxypropyl]-3-[2,2-dimethylpropyl(dimethyl)silyl]oxypiperidine-1-carboxylate (PubChem CID 141469979) has the molecular formula C29H42BrN3O6Si and a molecular weight of 636.66 g/mol. Its IUPAC name is benzyl (2R,3S)-2-[3-(4-bromo-2-nitroanilino)-2-hydroxypropyl]-3-[2,2-dimethylpropyl(dimethyl)silyl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-2-[3-(4-bromo-2-nitroanilino)-2-hydroxypropyl]-3-[2,2-dimethylpropyl(dimethyl)silyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 141469979 |
| Molecular Formula | C29H42BrN3O6Si |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | benzyl (2R,3S)-2-[3-(4-bromo-2-nitroanilino)-2-hydroxypropyl]-3-[2,2-dimethylpropyl(dimethyl)silyl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)C[Si](C)(C)O[C@H]1CCCN(C(=O)OCc2ccccc2)[C@@H]1CC(O)CNc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H42BrN3O6Si/c1-29(2,3)20-40(4,5)39-27-12-9-15-32(28(35)38-19-21-10-7-6-8-11-21)26(27)17-23(34)18-31-24-14-13-22(30)16-25(24)33(36)37/h6-8,10-11,13-14,16,23,26-27,31,34H,9,12,15,17-20H2,1-5H3/t23?,26-,27+/m1/s1 |
| InChIKey | MQCWZQNHTMLGCC-VNCAGCHFSA-N |
| XLogP | 6.96 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|