C23H23Cl2NO3 — CID 125180734
ethyl (1R,5R,6S)-2-benzoyl-5-benzyl-7,7-dichloro-2-azabicyclo[4.1.0]heptane-5-carboxylate (PubChem CID 125180734) has the molecular formula C23H23Cl2NO3 and a molecular weight of 432.35 g/mol. Its IUPAC name is ethyl (1R,5R,6S)-2-benzoyl-5-benzyl-7,7-dichloro-2-azabicyclo[4.1.0]heptane-5-carboxylate.
| Compound Name | ethyl (1R,5R,6S)-2-benzoyl-5-benzyl-7,7-dichloro-2-azabicyclo[4.1.0]heptane-5-carboxylate |
|---|---|
| PubChem CID | 125180734 |
| Molecular Formula | C23H23Cl2NO3 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | ethyl (1R,5R,6S)-2-benzoyl-5-benzyl-7,7-dichloro-2-azabicyclo[4.1.0]heptane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2)CCN(C(=O)c2ccccc2)[C@@H]2[C@H]1C2(Cl)Cl |
| InChI | InChI=1S/C23H23Cl2NO3/c1-2-29-21(28)22(15-16-9-5-3-6-10-16)13-14-26(19-18(22)23(19,24)25)20(27)17-11-7-4-8-12-17/h3-12,18-19H,2,13-15H2,1H3/t18-,19-,22+/m1/s1 |
| InChIKey | RCYHPNSOHVPTPQ-KNKQGSTJSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|