C17H20F2O2 — CID 162596594
benzyl (3aS)-5,5-difluoro-6a-methyl-1,2,3,3a,4,6-hexahydropentalene-2-carboxylate (PubChem CID 162596594) has the molecular formula C17H20F2O2 and a molecular weight of 294.34 g/mol. Its IUPAC name is benzyl (3aS)-5,5-difluoro-6a-methyl-1,2,3,3a,4,6-hexahydropentalene-2-carboxylate.
| Compound Name | benzyl (3aS)-5,5-difluoro-6a-methyl-1,2,3,3a,4,6-hexahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 162596594 |
| Molecular Formula | C17H20F2O2 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | benzyl (3aS)-5,5-difluoro-6a-methyl-1,2,3,3a,4,6-hexahydropentalene-2-carboxylate |
| SMILES | CC12CC(C(=O)OCc3ccccc3)C[C@H]1CC(F)(F)C2 |
| InChI | InChI=1S/C17H20F2O2/c1-16-8-13(7-14(16)9-17(18,19)11-16)15(20)21-10-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3/t13?,14-,16?/m0/s1 |
| InChIKey | AWZQZZWBSRGIER-BBBYJDLNSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |