C13H18N2O3 — CID 56924337
benzyl (3R,5S)-1-amino-5-(hydroxymethyl)pyrrolidine-3-carboxylate (PubChem CID 56924337) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is benzyl (3R,5S)-1-amino-5-(hydroxymethyl)pyrrolidine-3-carboxylate.
| Compound Name | benzyl (3R,5S)-1-amino-5-(hydroxymethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 56924337 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | benzyl (3R,5S)-1-amino-5-(hydroxymethyl)pyrrolidine-3-carboxylate |
| SMILES | NN1C[C@H](C(=O)OCc2ccccc2)C[C@H]1CO |
| InChI | InChI=1S/C13H18N2O3/c14-15-7-11(6-12(15)8-16)13(17)18-9-10-4-2-1-3-5-10/h1-5,11-12,16H,6-9,14H2/t11-,12+/m1/s1 |
| InChIKey | CLQWNMJGRPSXDT-NEPJUHHUSA-N |
| XLogP | 0.29 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|