C15H14ClNO3S — CID 10381563
[(1R,2R,4S,5R,6R)-5-chloro-2-cyano-6-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl] acetate (PubChem CID 10381563) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6R)-5-chloro-2-cyano-6-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl] acetate.
| Compound Name | [(1R,2R,4S,5R,6R)-5-chloro-2-cyano-6-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl] acetate |
|---|---|
| PubChem CID | 10381563 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | [(1R,2R,4S,5R,6R)-5-chloro-2-cyano-6-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C#N)C[C@@H]2O[C@H]1[C@@H](Sc1ccccc1)[C@@H]2Cl |
| InChI | InChI=1S/C15H14ClNO3S/c1-9(18)20-15(8-17)7-11-12(16)13(14(15)19-11)21-10-5-3-2-4-6-10/h2-6,11-14H,7H2,1H3/t11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | BXIDHLCHAUGVRE-AIEDFZFUSA-N |
| XLogP | 2.75 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|