C20H21ClO2S — CID 10021462
(1R,2S,4S,5S,6S)-6-chloro-2-methyl-2-phenylmethoxy-5-phenylsulfanyl-7-oxabicyclo[2.2.1]heptane (PubChem CID 10021462) has the molecular formula C20H21ClO2S and a molecular weight of 360.91 g/mol. Its IUPAC name is (1R,2S,4S,5S,6S)-6-chloro-2-methyl-2-phenylmethoxy-5-phenylsulfanyl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,4S,5S,6S)-6-chloro-2-methyl-2-phenylmethoxy-5-phenylsulfanyl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10021462 |
| Molecular Formula | C20H21ClO2S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (1R,2S,4S,5S,6S)-6-chloro-2-methyl-2-phenylmethoxy-5-phenylsulfanyl-7-oxabicyclo[2.2.1]heptane |
| SMILES | C[C@]1(OCc2ccccc2)C[C@@H]2O[C@H]1[C@H](Cl)[C@H]2Sc1ccccc1 |
| InChI | InChI=1S/C20H21ClO2S/c1-20(22-13-14-8-4-2-5-9-14)12-16-18(17(21)19(20)23-16)24-15-10-6-3-7-11-15/h2-11,16-19H,12-13H2,1H3/t16-,17+,18-,19-,20-/m0/s1 |
| InChIKey | BGFNBRLLAFRNSG-WPVAHCMFSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|