C21H23ClO2S — CID 10022317
(1R,2S,5S,6R,7R)-6-chloro-2-methyl-2-phenylmethoxy-7-phenylsulfanyl-8-oxabicyclo[3.2.1]octane (PubChem CID 10022317) has the molecular formula C21H23ClO2S and a molecular weight of 374.93 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-6-chloro-2-methyl-2-phenylmethoxy-7-phenylsulfanyl-8-oxabicyclo[3.2.1]octane.
| Compound Name | (1R,2S,5S,6R,7R)-6-chloro-2-methyl-2-phenylmethoxy-7-phenylsulfanyl-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10022317 |
| Molecular Formula | C21H23ClO2S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (1R,2S,5S,6R,7R)-6-chloro-2-methyl-2-phenylmethoxy-7-phenylsulfanyl-8-oxabicyclo[3.2.1]octane |
| SMILES | C[C@]1(OCc2ccccc2)CC[C@@H]2O[C@H]1[C@@H](Sc1ccccc1)[C@@H]2Cl |
| InChI | InChI=1S/C21H23ClO2S/c1-21(23-14-15-8-4-2-5-9-15)13-12-17-18(22)19(20(21)24-17)25-16-10-6-3-7-11-16/h2-11,17-20H,12-14H2,1H3/t17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | SOYISESKRJMFBK-SSTJLMRISA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|