C27H30O3S — CID 11316480
(2S,3R,4R)-2,4-dimethyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane (PubChem CID 11316480) has the molecular formula C27H30O3S and a molecular weight of 434.60 g/mol. Its IUPAC name is (2S,3R,4R)-2,4-dimethyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane.
| Compound Name | (2S,3R,4R)-2,4-dimethyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 11316480 |
| Molecular Formula | C27H30O3S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (2S,3R,4R)-2,4-dimethyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane |
| SMILES | C[C@@H]1OC(Sc2ccccc2)C[C@@](C)(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O3S/c1-21-26(28-19-22-12-6-3-7-13-22)27(2,29-20-23-14-8-4-9-15-23)18-25(30-21)31-24-16-10-5-11-17-24/h3-17,21,25-26H,18-20H2,1-2H3/t21-,25?,26+,27+/m0/s1 |
| InChIKey | WJIFOHFZLIIUEH-QKOIMYGBSA-N |
| XLogP | 6.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |