C20H20O5S — CID 11025112
(3aS,4S,6R,7R,7aR)-4-methyl-7-phenylmethoxy-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one (PubChem CID 11025112) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is (3aS,4S,6R,7R,7aR)-4-methyl-7-phenylmethoxy-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one.
| Compound Name | (3aS,4S,6R,7R,7aR)-4-methyl-7-phenylmethoxy-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
|---|---|
| PubChem CID | 11025112 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (3aS,4S,6R,7R,7aR)-4-methyl-7-phenylmethoxy-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
| SMILES | C[C@@H]1O[C@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@@H]2OC(=O)O[C@H]21 |
| InChI | InChI=1S/C20H20O5S/c1-13-16-17(25-20(21)24-16)18(22-12-14-8-4-2-5-9-14)19(23-13)26-15-10-6-3-7-11-15/h2-11,13,16-19H,12H2,1H3/t13-,16-,17+,18+,19+/m0/s1 |
| InChIKey | IIVMTIJSJAERHG-RKWNZTQVSA-N |
| XLogP | 4.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |