C15H13ClO3S — CID 124771137
(1R,2S,6R,7R,8S,9S)-8-chloro-9-phenylsulfanyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 124771137) has the molecular formula C15H13ClO3S and a molecular weight of 308.79 g/mol. Its IUPAC name is (1R,2S,6R,7R,8S,9S)-8-chloro-9-phenylsulfanyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7R,8S,9S)-8-chloro-9-phenylsulfanyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 124771137 |
| Molecular Formula | C15H13ClO3S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (1R,2S,6R,7R,8S,9S)-8-chloro-9-phenylsulfanyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]3C[C@@H]([C@H](Sc4ccccc4)[C@H]3Cl)[C@@H]12 |
| InChI | InChI=1S/C15H13ClO3S/c16-12-8-6-9(11-10(8)14(17)19-15(11)18)13(12)20-7-4-2-1-3-5-7/h1-5,8-13H,6H2/t8-,9-,10+,11-,12+,13+/m1/s1 |
| InChIKey | GDDMWAGYCZBBJZ-QKFSQAGISA-N |
| XLogP | 2.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|