C11H11BrO2S — CID 15885264
(3R,4R,5S)-5-bromo-3-methyl-4-phenylsulfanyloxolan-2-one (PubChem CID 15885264) has the molecular formula C11H11BrO2S and a molecular weight of 287.18 g/mol. Its IUPAC name is (3R,4R,5S)-5-bromo-3-methyl-4-phenylsulfanyloxolan-2-one.
| Compound Name | (3R,4R,5S)-5-bromo-3-methyl-4-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 15885264 |
| Molecular Formula | C11H11BrO2S |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | (3R,4R,5S)-5-bromo-3-methyl-4-phenylsulfanyloxolan-2-one |
| SMILES | C[C@@H]1C(=O)O[C@@H](Br)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C11H11BrO2S/c1-7-9(10(12)14-11(7)13)15-8-5-3-2-4-6-8/h2-7,9-10H,1H3/t7-,9+,10+/m0/s1 |
| InChIKey | KUHPUNHPSIFKNQ-FXBDTBDDSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|