C12H12O2S — CID 140674094
3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one (PubChem CID 140674094) has the molecular formula C12H12O2S and a molecular weight of 220.29 g/mol. Its IUPAC name is 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one.
| Compound Name | 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one |
|---|---|
| PubChem CID | 140674094 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one |
| SMILES | CC1=C(C)C(Sc2ccccc2)OC1=O |
| InChI | InChI=1S/C12H12O2S/c1-8-9(2)12(14-11(8)13)15-10-6-4-3-5-7-10/h3-7,12H,1-2H3 |
| InChIKey | NJPGAMLVGRCJNL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |