C10H11NO2S — CID 14237750
(4S,5S)-4-methyl-5-phenylsulfanyl-1,3-oxazolidin-2-one (PubChem CID 14237750) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is (4S,5S)-4-methyl-5-phenylsulfanyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-4-methyl-5-phenylsulfanyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14237750 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (4S,5S)-4-methyl-5-phenylsulfanyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1NC(=O)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C10H11NO2S/c1-7-9(13-10(12)11-7)14-8-5-3-2-4-6-8/h2-7,9H,1H3,(H,11,12)/t7-,9-/m0/s1 |
| InChIKey | ZICRWGDNCOZXJO-CBAPKCEASA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |