C13H14O3 — CID 20820559
3,4-dimethyl-2-phenylmethoxy-2H-furan-5-one (PubChem CID 20820559) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 3,4-dimethyl-2-phenylmethoxy-2H-furan-5-one.
| Compound Name | 3,4-dimethyl-2-phenylmethoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 20820559 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3,4-dimethyl-2-phenylmethoxy-2H-furan-5-one |
| SMILES | CC1=C(C)C(OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C13H14O3/c1-9-10(2)13(16-12(9)14)15-8-11-6-4-3-5-7-11/h3-7,13H,8H2,1-2H3 |
| InChIKey | XNTMUAMNUAHZBJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |