C16H22O2 — CID 24805775
(2R,3R,6R)-2-ethyl-3,5-dimethyl-6-phenylmethoxy-3,6-dihydro-2H-pyran (PubChem CID 24805775) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2R,3R,6R)-2-ethyl-3,5-dimethyl-6-phenylmethoxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3R,6R)-2-ethyl-3,5-dimethyl-6-phenylmethoxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 24805775 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2R,3R,6R)-2-ethyl-3,5-dimethyl-6-phenylmethoxy-3,6-dihydro-2H-pyran |
| SMILES | CC[C@H]1O[C@@H](OCc2ccccc2)C(C)=C[C@H]1C |
| InChI | InChI=1S/C16H22O2/c1-4-15-12(2)10-13(3)16(18-15)17-11-14-8-6-5-7-9-14/h5-10,12,15-16H,4,11H2,1-3H3/t12-,15-,16-/m1/s1 |
| InChIKey | STIKWJXCACDIAF-DAXOMENPSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|