C15H19IO2 — CID 170420184
(2R,3S,4S)-2-ethyl-5-iodo-3-methyl-4-phenylmethoxy-3,4-dihydro-2H-pyran (PubChem CID 170420184) has the molecular formula C15H19IO2 and a molecular weight of 358.22 g/mol. Its IUPAC name is (2R,3S,4S)-2-ethyl-5-iodo-3-methyl-4-phenylmethoxy-3,4-dihydro-2H-pyran.
| Compound Name | (2R,3S,4S)-2-ethyl-5-iodo-3-methyl-4-phenylmethoxy-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 170420184 |
| Molecular Formula | C15H19IO2 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (2R,3S,4S)-2-ethyl-5-iodo-3-methyl-4-phenylmethoxy-3,4-dihydro-2H-pyran |
| SMILES | CC[C@H]1OC=C(I)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C15H19IO2/c1-3-14-11(2)15(13(16)10-17-14)18-9-12-7-5-4-6-8-12/h4-8,10-11,14-15H,3,9H2,1-2H3/t11-,14+,15-/m0/s1 |
| InChIKey | LIHHMAFUCMYXRU-GLQYFDAESA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|