C16H26N2 — CID 915263
(2S,4S,5S)-N,N,1,2,5-pentamethyl-4-phenylpiperidin-4-amine (PubChem CID 915263) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (2S,4S,5S)-N,N,1,2,5-pentamethyl-4-phenylpiperidin-4-amine.
| Compound Name | (2S,4S,5S)-N,N,1,2,5-pentamethyl-4-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 915263 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (2S,4S,5S)-N,N,1,2,5-pentamethyl-4-phenylpiperidin-4-amine |
| SMILES | C[C@H]1C[C@](c2ccccc2)(N(C)C)[C@@H](C)CN1C |
| InChI | InChI=1S/C16H26N2/c1-13-12-18(5)14(2)11-16(13,17(3)4)15-9-7-6-8-10-15/h6-10,13-14H,11-12H2,1-5H3/t13-,14-,16-/m0/s1 |
| InChIKey | IUSBKFPERNESOI-DZKIICNBSA-N |
| XLogP | 2.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |