C18H26N2O — CID 7237267
(2S,4S,5R)-1,2,5-trimethyl-4-[3-(N-methylanilino)prop-1-ynyl]piperidin-4-ol (PubChem CID 7237267) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (2S,4S,5R)-1,2,5-trimethyl-4-[3-(N-methylanilino)prop-1-ynyl]piperidin-4-ol.
| Compound Name | (2S,4S,5R)-1,2,5-trimethyl-4-[3-(N-methylanilino)prop-1-ynyl]piperidin-4-ol |
|---|---|
| PubChem CID | 7237267 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (2S,4S,5R)-1,2,5-trimethyl-4-[3-(N-methylanilino)prop-1-ynyl]piperidin-4-ol |
| SMILES | C[C@@H]1CN(C)[C@@H](C)C[C@@]1(O)C#CCN(C)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O/c1-15-14-20(4)16(2)13-18(15,21)11-8-12-19(3)17-9-6-5-7-10-17/h5-7,9-10,15-16,21H,12-14H2,1-4H3/t15-,16+,18+/m1/s1 |
| InChIKey | GDXDUROGMQXTIE-RYRKJORJSA-N |
| XLogP | 2.22 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|