C9H12N2O7 — CID 88652651
[6-(oxiran-2-ylmethoxyimino)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 88652651) has the molecular formula C9H12N2O7 and a molecular weight of 260.20 g/mol. Its IUPAC name is [6-(oxiran-2-ylmethoxyimino)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [6-(oxiran-2-ylmethoxyimino)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 88652651 |
| Molecular Formula | C9H12N2O7 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | [6-(oxiran-2-ylmethoxyimino)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | O=[N+]([O-])OC1COC2C(=NOCC3CO3)COC12 |
| InChI | InChI=1S/C9H12N2O7/c12-11(13)18-7-4-16-8-6(3-15-9(7)8)10-17-2-5-1-14-5/h5,7-9H,1-4H2 |
| InChIKey | HVDUSKBITUBAOO-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 104.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|