C6H8N2O6 — CID 73120914
(6-hydroxyimino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl) nitrate (PubChem CID 73120914) has the molecular formula C6H8N2O6 and a molecular weight of 204.14 g/mol. Its IUPAC name is (6-hydroxyimino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl) nitrate.
| Compound Name | (6-hydroxyimino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl) nitrate |
|---|---|
| PubChem CID | 73120914 |
| Molecular Formula | C6H8N2O6 |
| Molecular Weight | 204.14 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (6-hydroxyimino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl) nitrate |
| SMILES | O=[N+]([O-])OC1COC2C(=NO)COC12 |
| InChI | InChI=1S/C6H8N2O6/c9-7-3-1-12-6-4(14-8(10)11)2-13-5(3)6/h4-6,9H,1-2H2 |
| InChIKey | MMXZZYXNQPOKFA-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.14 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|