C16H22N4O7 — CID 70380212
1-[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 70380212) has the molecular formula C16H22N4O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is 1-[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70380212 |
| Molecular Formula | C16H22N4O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[3-[(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-2-hydroxypropyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CC(O)C[C@]13OC[C@@H](O)[C@H]1OC[C@@H]3O)c(=O)n2C |
| InChI | InChI=1S/C16H22N4O7/c1-18-7-17-13-11(18)14(24)20(15(25)19(13)2)4-8(21)3-16-10(23)6-26-12(16)9(22)5-27-16/h7-10,12,21-23H,3-6H2,1-2H3/t8?,9-,10+,12-,16-/m1/s1 |
| InChIKey | JAJYGOQRCIPDGP-HABJKNKFSA-N |
| XLogP | -2.93 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |