About acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury
acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury (PubChem CID 16683626) has the molecular formula C12H16HgN4O5
and a molecular weight of 496.87 g/mol. Its IUPAC name is acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury.
Molecular Properties
| Compound Name | acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury |
| PubChem CID | 16683626 |
| Molecular Formula | C12H16HgN4O5 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury |
| SMILES | CC(=O)O[Hg]CC(O)Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C10H13N4O3.C2H4O2.Hg/c1-6(15)4-14-9(16)7-8(11-5-12(7)2)13(3)10(14)17;1-2(3)4;/h5-6,15H,1,4H2,2-3H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | MTGCHKZZBOQQPN-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury?
The IUPAC name of acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury (CID 16683626) is acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury.
What is the SMILES notation for acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury?
The canonical SMILES for acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury is CC(=O)O[Hg]CC(O)Cn1c(=O)c2c(ncn2C)n(C)c1=O.
What is the InChIKey of acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury?
The InChIKey is MTGCHKZZBOQQPN-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13N4O3.C2H4O2.Hg/c1-6(15)4-14-9(16)7-8(11-5-12(7)2)13(3)10(14)17;1-2(3)4;/h5-6,15H,1,4H2,2-3H3;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury?
acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury has a molecular weight of 496.87 g/mol, XLogP of -1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxy-[3-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxypropyl]mercury is sourced from PubChem (CID 16683626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).