C17H28N4O4 — CID 23295924
1-(2,3-dihydroxy-3,7-dimethyloctyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 23295924) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(2,3-dihydroxy-3,7-dimethyloctyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-(2,3-dihydroxy-3,7-dimethyloctyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 23295924 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 1-(2,3-dihydroxy-3,7-dimethyloctyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(C)CCCC(C)(O)C(O)Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C17H28N4O4/c1-11(2)7-6-8-17(3,25)12(22)9-21-15(23)13-14(18-10-19(13)4)20(5)16(21)24/h10-12,22,25H,6-9H2,1-5H3 |
| InChIKey | TXOIJXPQGGZMBM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |