C13H24N8O4 — CID 123893125
3,7-dimethyl-1-(4,4,6,6-tetraamino-5,6-dihydroxyhexyl)purine-2,6-dione (PubChem CID 123893125) has the molecular formula C13H24N8O4 and a molecular weight of 356.39 g/mol. Its IUPAC name is 3,7-dimethyl-1-(4,4,6,6-tetraamino-5,6-dihydroxyhexyl)purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(4,4,6,6-tetraamino-5,6-dihydroxyhexyl)purine-2,6-dione |
|---|---|
| PubChem CID | 123893125 |
| Molecular Formula | C13H24N8O4 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3,7-dimethyl-1-(4,4,6,6-tetraamino-5,6-dihydroxyhexyl)purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCC(N)(N)C(O)C(N)(N)O)c(=O)n2C |
| InChI | InChI=1S/C13H24N8O4/c1-19-6-18-8-7(19)9(22)21(11(24)20(8)2)5-3-4-12(14,15)10(23)13(16,17)25/h6,10,23,25H,3-5,14-17H2,1-2H3 |
| InChIKey | NNKOVVJAQPYEJJ-UHFFFAOYSA-N |
| XLogP | -4.25 |
| TPSA | 206.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|