C27H32N4O8 — CID 70584701
(E)-but-2-enedioic acid;6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3-dimethyl-5-phenylpyrimidine-2,4-dione (PubChem CID 70584701) has the molecular formula C27H32N4O8 and a molecular weight of 540.57 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3-dimethyl-5-phenylpyrimidine-2,4-dione.
| Compound Name | (E)-but-2-enedioic acid;6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3-dimethyl-5-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70584701 |
| Molecular Formula | C27H32N4O8 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | (E)-but-2-enedioic acid;6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethylamino]-1,3-dimethyl-5-phenylpyrimidine-2,4-dione |
| SMILES | Cn1c(NCCNCC(O)COc2ccccc2)c(-c2ccccc2)c(=O)n(C)c1=O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H28N4O4.C4H4O4/c1-26-21(20(17-9-5-3-6-10-17)22(29)27(2)23(26)30)25-14-13-24-15-18(28)16-31-19-11-7-4-8-12-19;5-3(6)1-2-4(7)8/h3-12,18,24-25,28H,13-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | LYTAOKBVLYYSQO-WLHGVMLRSA-N |
| XLogP | 0.90 |
| TPSA | 172.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|