C27H30N4O7 — CID 70454392
(E)-4-[1-[2-[(1,3-dimethyl-2,6-dioxo-5-phenylpyrimidin-4-yl)amino]ethylamino]-3-phenoxypropan-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 70454392) has the molecular formula C27H30N4O7 and a molecular weight of 522.56 g/mol. Its IUPAC name is (E)-4-[1-[2-[(1,3-dimethyl-2,6-dioxo-5-phenylpyrimidin-4-yl)amino]ethylamino]-3-phenoxypropan-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[1-[2-[(1,3-dimethyl-2,6-dioxo-5-phenylpyrimidin-4-yl)amino]ethylamino]-3-phenoxypropan-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 70454392 |
| Molecular Formula | C27H30N4O7 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (E)-4-[1-[2-[(1,3-dimethyl-2,6-dioxo-5-phenylpyrimidin-4-yl)amino]ethylamino]-3-phenoxypropan-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | Cn1c(NCCNCC(COc2ccccc2)OC(=O)/C=C/C(=O)O)c(-c2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C27H30N4O7/c1-30-25(24(19-9-5-3-6-10-19)26(35)31(2)27(30)36)29-16-15-28-17-21(38-23(34)14-13-22(32)33)18-37-20-11-7-4-8-12-20/h3-14,21,28-29H,15-18H2,1-2H3,(H,32,33)/b14-13+ |
| InChIKey | NUCWCPCKQLYYRY-BUHFOSPRSA-N |
| XLogP | 1.38 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|