C62H58N2O16 — CID 88618410
bis[1-[2-[4-(2-methoxy-2-oxoethoxy)phenyl]ethylamino]-3-(4-oxo-2-phenylchromen-7-yl)oxypropan-2-yl] (Z)-but-2-enedioate (PubChem CID 88618410) has the molecular formula C62H58N2O16 and a molecular weight of 1087.14 g/mol. Its IUPAC name is bis[1-[2-[4-(2-methoxy-2-oxoethoxy)phenyl]ethylamino]-3-(4-oxo-2-phenylchromen-7-yl)oxypropan-2-yl] (Z)-but-2-enedioate.
| Compound Name | bis[1-[2-[4-(2-methoxy-2-oxoethoxy)phenyl]ethylamino]-3-(4-oxo-2-phenylchromen-7-yl)oxypropan-2-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88618410 |
| Molecular Formula | C62H58N2O16 |
| Molecular Weight | 1087.14 g/mol |
| Exact Mass | 1086.38 |
| IUPAC Name | bis[1-[2-[4-(2-methoxy-2-oxoethoxy)phenyl]ethylamino]-3-(4-oxo-2-phenylchromen-7-yl)oxypropan-2-yl] (Z)-but-2-enedioate |
| SMILES | COC(=O)COc1ccc(CCNCC(COc2ccc3c(=O)cc(-c4ccccc4)oc3c2)OC(=O)/C=C\C(=O)OC(CNCCc2ccc(OCC(=O)OC)cc2)COc2ccc3c(=O)cc(-c4ccccc4)oc3c2)cc1 |
| InChI | InChI=1S/C62H58N2O16/c1-71-61(69)39-75-45-17-13-41(14-18-45)27-29-63-35-49(37-73-47-21-23-51-53(65)33-55(79-57(51)31-47)43-9-5-3-6-10-43)77-59(67)25-26-60(68)78-50(36-64-30-28-42-15-19-46(20-16-42)76-40-62(70)72-2)38-74-48-22-24-52-54(66)34-56(80-58(52)32-48)44-11-7-4-8-12-44/h3-26,31-34,49-50,63-64H,27-30,35-40H2,1-2H3/b26-25- |
| InChIKey | KCWTYXSCCKUWDX-QPLCGJKRSA-N |
| XLogP | 7.84 |
| TPSA | 226.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.14 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|