C35H32F3NO5 — CID 162663994
4-methyl-7-[2-phenoxy-3-(2-phenylethylamino)propoxy]-3-[[4-(trifluoromethoxy)phenyl]methyl]chromen-2-one (PubChem CID 162663994) has the molecular formula C35H32F3NO5 and a molecular weight of 603.64 g/mol. Its IUPAC name is 4-methyl-7-[2-phenoxy-3-(2-phenylethylamino)propoxy]-3-[[4-(trifluoromethoxy)phenyl]methyl]chromen-2-one.
| Compound Name | 4-methyl-7-[2-phenoxy-3-(2-phenylethylamino)propoxy]-3-[[4-(trifluoromethoxy)phenyl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 162663994 |
| Molecular Formula | C35H32F3NO5 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 4-methyl-7-[2-phenoxy-3-(2-phenylethylamino)propoxy]-3-[[4-(trifluoromethoxy)phenyl]methyl]chromen-2-one |
| SMILES | Cc1c(Cc2ccc(OC(F)(F)F)cc2)c(=O)oc2cc(OCC(CNCCc3ccccc3)Oc3ccccc3)ccc12 |
| InChI | InChI=1S/C35H32F3NO5/c1-24-31-17-16-29(21-33(31)43-34(40)32(24)20-26-12-14-28(15-13-26)44-35(36,37)38)41-23-30(42-27-10-6-3-7-11-27)22-39-19-18-25-8-4-2-5-9-25/h2-17,21,30,39H,18-20,22-23H2,1H3 |
| InChIKey | KBZCFOJSTAHPOK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|