C26H26ClNO4 — CID 14626307
7-[2-hydroxy-3-(2-phenylethylamino)propoxy]-2-phenylchromen-4-one;hydrochloride (PubChem CID 14626307) has the molecular formula C26H26ClNO4 and a molecular weight of 451.95 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(2-phenylethylamino)propoxy]-2-phenylchromen-4-one;hydrochloride.
| Compound Name | 7-[2-hydroxy-3-(2-phenylethylamino)propoxy]-2-phenylchromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 14626307 |
| Molecular Formula | C26H26ClNO4 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 7-[2-hydroxy-3-(2-phenylethylamino)propoxy]-2-phenylchromen-4-one;hydrochloride |
| SMILES | Cl.O=c1cc(-c2ccccc2)oc2cc(OCC(O)CNCCc3ccccc3)ccc12 |
| InChI | InChI=1S/C26H25NO4.ClH/c28-21(17-27-14-13-19-7-3-1-4-8-19)18-30-22-11-12-23-24(29)16-25(31-26(23)15-22)20-9-5-2-6-10-20;/h1-12,15-16,21,27-28H,13-14,17-18H2;1H |
| InChIKey | ARFLYRVQKJQSQP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|