C22H25NO5 — CID 14408569
7-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxy-2-phenylchromen-4-one (PubChem CID 14408569) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxy-2-phenylchromen-4-one.
| Compound Name | 7-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 14408569 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 7-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxy-2-phenylchromen-4-one |
| SMILES | COc1c(-c2ccccc2)oc2cc(OCC(O)CNC(C)C)ccc2c1=O |
| InChI | InChI=1S/C22H25NO5/c1-14(2)23-12-16(24)13-27-17-9-10-18-19(11-17)28-21(22(26-3)20(18)25)15-7-5-4-6-8-15/h4-11,14,16,23-24H,12-13H2,1-3H3 |
| InChIKey | RVZDTYTTWWYWKG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |